* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34305055 |
English Synonyms: | UKRORGSYN-BB BBV-34305055 |
MDL Number.: | MFCD16771198 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCN(CC)Cc1csc(n1)CNC |
InChi: | InChI=1S/C12H23N3S/c1-4-6-7-15(5-2)9-11-10-16-12(14-11)8-13-3/h10,13H,4-9H2,1-3H3 |
InChiKey: | InChIKey=LWGZWTXMDIFFBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.