* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34305058 |
English Synonyms: | UKRORGSYN-BB BBV-34305058 |
MDL Number.: | MFCD16771201 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCN(CC)C(CNC1CC1)C(C)C |
InChi: | InChI=1S/C14H30N2/c1-5-7-10-16(6-2)14(12(3)4)11-15-13-8-9-13/h12-15H,5-11H2,1-4H3 |
InChiKey: | InChIKey=QVNRXFQIGUGEJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.