* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34305072 |
English Synonyms: | UKRORGSYN-BB BBV-34305072 |
MDL Number.: | MFCD16771210 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCCN(CC)Cc1cc(no1)CNC |
InChi: | InChI=1S/C12H23N3O/c1-4-6-7-15(5-2)10-12-8-11(9-13-3)14-16-12/h8,13H,4-7,9-10H2,1-3H3 |
InChiKey: | InChIKey=NZVDSAXIFNIFOV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.