* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34305837 |
English Synonyms: | UKRORGSYN-BB BBV-34305837 |
MDL Number.: | MFCD16771826 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCNCc1ccc(o1)CN(C)CC(C)C |
InChi: | InChI=1S/C13H24N2O/c1-5-14-8-12-6-7-13(16-12)10-15(4)9-11(2)3/h6-7,11,14H,5,8-10H2,1-4H3 |
InChiKey: | InChIKey=OHFNAJIRUOMMTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.