* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34305840 |
English Synonyms: | UKRORGSYN-BB BBV-34305840 |
MDL Number.: | MFCD16771829 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)CN(C)CCn1cc(nn1)CNC |
InChi: | InChI=1S/C11H23N5/c1-10(2)8-15(4)5-6-16-9-11(7-12-3)13-14-16/h9-10,12H,5-8H2,1-4H3 |
InChiKey: | InChIKey=ALWRFHCKXGLBDV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.