* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34306634 |
English Synonyms: | UKRORGSYN-BB BBV-34306634 |
MDL Number.: | MFCD16772397 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCc1cc(on1)CN2CCC(C2)C |
InChi: | InChI=1S/C12H21N3O/c1-3-13-7-11-6-12(16-14-11)9-15-5-4-10(2)8-15/h6,10,13H,3-5,7-9H2,1-2H3 |
InChiKey: | InChIKey=IPJZVXXLKXYBEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.