* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34306729 |
English Synonyms: | UKRORGSYN-BB BBV-34306729 |
MDL Number.: | MFCD16772456 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CN(Cc1ccc(o1)CN)Cc2cscn2 |
InChi: | InChI=1S/C11H15N3OS/c1-14(5-9-7-16-8-13-9)6-11-3-2-10(4-12)15-11/h2-3,7-8H,4-6,12H2,1H3 |
InChiKey: | InChIKey=DVQRLMJCLMNLPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.