* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34306735 |
English Synonyms: | UKRORGSYN-BB BBV-34306735 |
MDL Number.: | MFCD16772462 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CN(Cc1cc(co1)CN)Cc2cscn2 |
InChi: | InChI=1S/C11H15N3OS/c1-14(4-10-7-16-8-13-10)5-11-2-9(3-12)6-15-11/h2,6-8H,3-5,12H2,1H3 |
InChiKey: | InChIKey=JPXRRINKXVKOLE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.