* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34307531 |
English Synonyms: | UKRORGSYN-BB BBV-34307531 |
MDL Number.: | MFCD16772999 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CNCCCCCN(C)Cc1cc(sc1)Br |
InChi: | InChI=1S/C12H21BrN2S/c1-14-6-4-3-5-7-15(2)9-11-8-12(13)16-10-11/h8,10,14H,3-7,9H2,1-2H3 |
InChiKey: | InChIKey=UEBHGFJHFKFHRK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.