* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34307575 |
English Synonyms: | UKRORGSYN-BB BBV-34307575 |
MDL Number.: | MFCD16773033 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCN(Cc1ccco1)C(CNC)C(C)C |
InChi: | InChI=1S/C13H24N2O/c1-5-15(10-12-7-6-8-16-12)13(9-14-4)11(2)3/h6-8,11,13-14H,5,9-10H2,1-4H3 |
InChiKey: | InChIKey=KFEJBUIRGNBDED-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.