* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34307698 |
English Synonyms: | UKRORGSYN-BB BBV-34307698 |
MDL Number.: | MFCD16773116 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cc(oc1CNC)CN(C)CCOC |
InChi: | InChI=1S/C12H22N2O2/c1-10-7-11(16-12(10)8-13-2)9-14(3)5-6-15-4/h7,13H,5-6,8-9H2,1-4H3 |
InChiKey: | InChIKey=VUMHIRAIFRAUSL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.