* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308372 |
English Synonyms: | UKRORGSYN-BB BBV-34308372 |
MDL Number.: | MFCD16773655 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC(CNC)Oc1ccccc1/C=C/C |
InChi: | InChI=1S/C14H21NO/c1-4-8-12-9-6-7-10-14(12)16-13(5-2)11-15-3/h4,6-10,13,15H,5,11H2,1-3H3/b8-4+ |
InChiKey: | InChIKey=POVDMTYYUAJZLX-XBXARRHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.