* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308442 |
English Synonyms: | UKRORGSYN-BB BBV-34308442 |
MDL Number.: | MFCD16773717 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C=CCCOCc1ccc(o1)CNC2CC2 |
InChi: | InChI=1S/C13H19NO2/c1-2-3-8-15-10-13-7-6-12(16-13)9-14-11-4-5-11/h2,6-7,11,14H,1,3-5,8-10H2 |
InChiKey: | InChIKey=VKPUCAITPZYFRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.