* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34309126 |
English Synonyms: | UKRORGSYN-BB BBV-34309126 |
MDL Number.: | MFCD16774313 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)CCCOCc1cc(no1)CNC |
InChi: | InChI=1S/C12H22N2O2/c1-10(2)5-4-6-15-9-12-7-11(8-13-3)14-16-12/h7,10,13H,4-6,8-9H2,1-3H3 |
InChiKey: | InChIKey=MDYXQIKLIUCJRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.