* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34312717 |
English Synonyms: | UKRORGSYN-BB BBV-34312717 |
MDL Number.: | MFCD16777385 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1cc(nc(n1)Cl)N2CCS(=O)(=O)CC2 |
InChi: | InChI=1S/C9H12ClN3O2S/c1-7-6-8(12-9(10)11-7)13-2-4-16(14,15)5-3-13/h6H,2-5H2,1H3 |
InChiKey: | InChIKey=CVZJDFNXUDVUNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.