* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34314023 |
English Synonyms: | UKRORGSYN-BB BBV-34314023 |
MDL Number.: | MFCD16778602 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCc1cccc(n1)n2ccc(n2)C |
InChi: | InChI=1S/C12H16N4/c1-3-13-9-11-5-4-6-12(14-11)16-8-7-10(2)15-16/h4-8,13H,3,9H2,1-2H3 |
InChiKey: | InChIKey=PIEGYUWLJAJFMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.