* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34316182 |
| English Synonyms: | UKRORGSYN-BB BBV-34316182 |
| MDL Number.: | MFCD16780376 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCCOc1cccc(c1)/C=C(/C)\[N+](=O)[O-] |
| InChi: | InChI=1S/C12H15NO3/c1-3-7-16-12-6-4-5-11(9-12)8-10(2)13(14)15/h4-6,8-9H,3,7H2,1-2H3/b10-8- |
| InChiKey: | InChIKey=YXNKPDKLYKTOIW-NTMALXAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.