* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34316396 |
English Synonyms: | UKRORGSYN-BB BBV-34316396 |
MDL Number.: | MFCD16780524 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C=CCn1cnc2ccc(cc2c1=O)N |
InChi: | InChI=1S/C11H11N3O/c1-2-5-14-7-13-10-4-3-8(12)6-9(10)11(14)15/h2-4,6-7H,1,5,12H2 |
InChiKey: | InChIKey=ZPGHLLYHHKHWAK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.