* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34316971 |
English Synonyms: | UKRORGSYN-BB BBV-34316971 |
MDL Number.: | MFCD16781027 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1ccc(c(c1)/C(=C(/C)\C#N)/Cl)OC |
InChi: | InChI=1S/C12H12ClNO/c1-8-4-5-11(15-3)10(6-8)12(13)9(2)7-14/h4-6H,1-3H3/b12-9+ |
InChiKey: | InChIKey=JFHVWIBGPCZHHH-FMIVXFBMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.