* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34316992 |
English Synonyms: | UKRORGSYN-BB BBV-34316992 |
MDL Number.: | MFCD16781047 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C[C@@H](C(=O)O)NC(=O)Cc1cccc(c1)Cl |
InChi: | InChI=1S/C11H12ClNO3/c1-7(11(15)16)13-10(14)6-8-3-2-4-9(12)5-8/h2-5,7H,6H2,1H3,(H,13,14)(H,15,16)/t7-/m0/s1 |
InChiKey: | InChIKey=KSXWPWDMLRUMEA-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.