* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34317008 |
English Synonyms: | UKRORGSYN-BB BBV-34317008 |
MDL Number.: | MFCD16781057 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)Cl)CC(=O)C2=CCCCC2 |
InChi: | InChI=1S/C14H15ClO/c15-13-8-4-5-11(9-13)10-14(16)12-6-2-1-3-7-12/h4-6,8-9H,1-3,7,10H2 |
InChiKey: | InChIKey=LNSPIJGCQAIJQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.