* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34318754 |
English Synonyms: | UKRORGSYN-BB BBV-34318754 |
MDL Number.: | MFCD16782447 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)CC(Cc1cscn1)CNC(C)C |
InChi: | InChI=1S/C13H24N2S/c1-10(2)5-12(7-14-11(3)4)6-13-8-16-9-15-13/h8-12,14H,5-7H2,1-4H3 |
InChiKey: | InChIKey=SSYKRJCHYWCZOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.