* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34319470 |
| English Synonyms: | UKRORGSYN-BB BBV-34319470 |
| MDL Number.: | MFCD16783136 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCC(Cc1cccs1)CNCC(C)C |
| InChi: | InChI=1S/C13H23NS/c1-4-12(10-14-9-11(2)3)8-13-6-5-7-15-13/h5-7,11-12,14H,4,8-10H2,1-3H3 |
| InChiKey: | InChIKey=GJGNKTWJCYMHHR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.