* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34319472 |
English Synonyms: | UKRORGSYN-BB BBV-34319472 |
MDL Number.: | MFCD16783138 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(Cc1ccc(s1)Cl)CNCC(C)C |
InChi: | InChI=1S/C13H22ClNS/c1-4-11(9-15-8-10(2)3)7-12-5-6-13(14)16-12/h5-6,10-11,15H,4,7-9H2,1-3H3 |
InChiKey: | InChIKey=CYCKEDNTISODEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.