* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34320141 |
| English Synonyms: | UKRORGSYN-BB BBV-34320141 |
| MDL Number.: | MFCD16783739 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCNCC1CCN(C1)CCc2cccs2 |
| InChi: | InChI=1S/C13H22N2S/c1-2-14-10-12-5-7-15(11-12)8-6-13-4-3-9-16-13/h3-4,9,12,14H,2,5-8,10-11H2,1H3 |
| InChiKey: | InChIKey=MULZVSKORIIFQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.