* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320732 |
English Synonyms: | UKRORGSYN-BB BBV-34320732 |
MDL Number.: | MFCD16784301 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | Cc1ccc(o1)CNC(=S)NN |
InChi: | InChI=1S/C7H11N3OS/c1-5-2-3-6(11-5)4-9-7(12)10-8/h2-3H,4,8H2,1H3,(H2,9,10,12) |
InChiKey: | InChIKey=GYURVPLISXCCTM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.