* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320751 |
English Synonyms: | UKRORGSYN-BB BBV-34320751 |
MDL Number.: | MFCD16784320 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CCCNC(=N)NCc1ccc(o1)C |
InChi: | InChI=1S/C10H17N3O/c1-3-6-12-10(11)13-7-9-5-4-8(2)14-9/h4-5H,3,6-7H2,1-2H3,(H3,11,12,13) |
InChiKey: | InChIKey=VYHCOXGSJMNFMZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.