* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34320771 |
| English Synonyms: | UKRORGSYN-BB BBV-34320771 |
| MDL Number.: | MFCD16784340 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(o1)CNCCCCCCN |
| InChi: | InChI=1S/C12H22N2O/c1-11-6-7-12(15-11)10-14-9-5-3-2-4-8-13/h6-7,14H,2-5,8-10,13H2,1H3 |
| InChiKey: | InChIKey=AZGGAOQNOICTEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.