* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34320773 |
| English Synonyms: | UKRORGSYN-BB BBV-34320773 |
| MDL Number.: | MFCD16784342 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(o1)CNCC(C(C)C)N |
| InChi: | InChI=1S/C11H20N2O/c1-8(2)11(12)7-13-6-10-5-4-9(3)14-10/h4-5,8,11,13H,6-7,12H2,1-3H3 |
| InChiKey: | InChIKey=DMUSFRYLGXNLND-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.