* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34320800 |
| English Synonyms: | UKRORGSYN-BB BBV-34320800 |
| MDL Number.: | MFCD16784369 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(o1)CNC2=NC(CS2)(C)C |
| InChi: | InChI=1S/C11H16N2OS/c1-8-4-5-9(14-8)6-12-10-13-11(2,3)7-15-10/h4-5H,6-7H2,1-3H3,(H,12,13) |
| InChiKey: | InChIKey=YUVOISMYEPSUBN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.