* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34320803 |
| English Synonyms: | UKRORGSYN-BB BBV-34320803 |
| MDL Number.: | MFCD16784372 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(o1)Cn2c(nnn2)S |
| InChi: | InChI=1S/C7H8N4OS/c1-5-2-3-6(12-5)4-11-7(13)8-9-10-11/h2-3H,4H2,1H3,(H,8,10,13) |
| InChiKey: | InChIKey=SXNLZEPTLBBPFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.