* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34320804 |
| English Synonyms: | UKRORGSYN-BB BBV-34320804 |
| MDL Number.: | MFCD16784373 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(o1)CNS(=O)(=O)CCNC |
| InChi: | InChI=1S/C9H16N2O3S/c1-8-3-4-9(14-8)7-11-15(12,13)6-5-10-2/h3-4,10-11H,5-7H2,1-2H3 |
| InChiKey: | InChIKey=BXQSOGINRCYJTL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.