* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34321265 |
English Synonyms: | UKRORGSYN-BB BBV-34321265 |
MDL Number.: | MFCD16784808 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C/C=C/C(=O)NC1(CCCC1)CO |
InChi: | InChI=1S/C10H17NO2/c1-2-5-9(13)11-10(8-12)6-3-4-7-10/h2,5,12H,3-4,6-8H2,1H3,(H,11,13)/b5-2+ |
InChiKey: | InChIKey=AFZZNMIQEDXFIB-GORDUTHDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.