* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34321267 |
English Synonyms: | UKRORGSYN-BB BBV-34321267 |
MDL Number.: | MFCD16784810 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C/C=C/C=C/C(=O)NC1(CCCC1)CO |
InChi: | InChI=1S/C12H19NO2/c1-2-3-4-7-11(15)13-12(10-14)8-5-6-9-12/h2-4,7,14H,5-6,8-10H2,1H3,(H,13,15)/b3-2+,7-4+ |
InChiKey: | InChIKey=ZNBZCWBTBQNWLS-AOGGBPEJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.