* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34321287 |
English Synonyms: | UKRORGSYN-BB BBV-34321287 |
MDL Number.: | MFCD16784828 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC1(CSC(=N1)NCCCCOC)CC |
InChi: | InChI=1S/C12H24N2OS/c1-4-12(5-2)10-16-11(14-12)13-8-6-7-9-15-3/h4-10H2,1-3H3,(H,13,14) |
InChiKey: | InChIKey=PAGXYEUUGPKMIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.