* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34321313 |
English Synonyms: | UKRORGSYN-BB BBV-34321313 |
MDL Number.: | MFCD16784854 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC1(CSC(=N1)NC2CC2C)CC |
InChi: | InChI=1S/C11H20N2S/c1-4-11(5-2)7-14-10(13-11)12-9-6-8(9)3/h8-9H,4-7H2,1-3H3,(H,12,13) |
InChiKey: | InChIKey=WJLSKFFBAXPJNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.