* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34321435 |
| English Synonyms: | UKRORGSYN-BB BBV-34321435 |
| MDL Number.: | MFCD16784969 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1CCC(C1)(CO)NC#N |
| InChi: | InChI=1S/C7H12N2O/c8-6-9-7(5-10)3-1-2-4-7/h9-10H,1-5H2 |
| InChiKey: | InChIKey=IUKCPQQAMSDXKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.