* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34321939 |
English Synonyms: | UKRORGSYN-BB BBV-34321939 |
MDL Number.: | MFCD16785464 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCC(CC)(CO)NS(=O)(=O)c1cccs1 |
InChi: | InChI=1S/C10H17NO3S2/c1-3-10(4-2,8-12)11-16(13,14)9-6-5-7-15-9/h5-7,11-12H,3-4,8H2,1-2H3 |
InChiKey: | InChIKey=GBCOIWKVUVGSKH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.