* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34322039 |
| English Synonyms: | UKRORGSYN-BB BBV-34322039 |
| MDL Number.: | MFCD16785560 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C1CCC2(CC1)COC3CCOCC3N2 |
| InChi: | InChI=1S/C12H21NO2/c1-2-5-12(6-3-1)9-15-11-4-7-14-8-10(11)13-12/h10-11,13H,1-9H2 |
| InChiKey: | InChIKey=WLBWHKNPSDLXQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.