* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34322082 |
| English Synonyms: | UKRORGSYN-BB BBV-34322082 |
| MDL Number.: | MFCD16785598 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC/C=C(/C)\C(=O)NC1(CCCCC1)CO |
| InChi: | InChI=1S/C13H23NO2/c1-3-7-11(2)12(16)14-13(10-15)8-5-4-6-9-13/h7,15H,3-6,8-10H2,1-2H3,(H,14,16)/b11-7- |
| InChiKey: | InChIKey=FOXYOIHFERPTOD-XFFZJAGNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.