* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34322719 |
English Synonyms: | UKRORGSYN-BB BBV-34322719 |
MDL Number.: | MFCD16786197 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc(cnc1)Cc2nc(cs2)CCl |
InChi: | InChI=1S/C10H9ClN2S/c11-5-9-7-14-10(13-9)4-8-2-1-3-12-6-8/h1-3,6-7H,4-5H2 |
InChiKey: | InChIKey=GGZNSXIDITWICC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.