* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34323363 |
| English Synonyms: | UKRORGSYN-BB BBV-34323363 |
| MDL Number.: | MFCD16786757 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c(c1)CC(C2=CCCC2)O)C |
| InChi: | InChI=1S/C15H20O/c1-11-7-8-12(2)14(9-11)10-15(16)13-5-3-4-6-13/h5,7-9,15-16H,3-4,6,10H2,1-2H3 |
| InChiKey: | InChIKey=QLMXPDDGLQBEHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.