* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34323425 |
English Synonyms: | UKRORGSYN-BB BBV-34323425 |
MDL Number.: | MFCD16786797 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(c1nnc2n1cc(cc2)N)O |
InChi: | InChI=1S/C8H10N4O/c1-5(13)8-11-10-7-3-2-6(9)4-12(7)8/h2-5,13H,9H2,1H3 |
InChiKey: | InChIKey=BMABRVFCCUGGIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.