* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34323957 |
English Synonyms: | UKRORGSYN-BB BBV-34323957 |
MDL Number.: | MFCD16787276 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1cc(c(c(c1N)NCc2c[nH]nc2)F)F |
InChi: | InChI=1S/C10H10F2N4/c11-7-1-2-8(13)10(9(7)12)14-3-6-4-15-16-5-6/h1-2,4-5,14H,3,13H2,(H,15,16) |
InChiKey: | InChIKey=SGLOCHXSBTYZFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.