* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34324587 |
English Synonyms: | UKRORGSYN-BB BBV-34324587 |
MDL Number.: | MFCD16787823 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(Cn1ccnc1)NC(C)COC |
InChi: | InChI=1S/C10H19N3O/c1-9(12-10(2)7-14-3)6-13-5-4-11-8-13/h4-5,8-10,12H,6-7H2,1-3H3 |
InChiKey: | InChIKey=JFYSWUMYUUUOEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.