* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34324613 |
English Synonyms: | UKRORGSYN-BB BBV-34324613 |
MDL Number.: | MFCD16787849 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(COC)Nc1ccn(n1)C |
InChi: | InChI=1S/C8H15N3O/c1-7(6-12-3)9-8-4-5-11(2)10-8/h4-5,7H,6H2,1-3H3,(H,9,10) |
InChiKey: | InChIKey=IRSCHWJMXFZINC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.