* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34325777 |
English Synonyms: | UKRORGSYN-BB BBV-34325777 |
MDL Number.: | MFCD16788968 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CNC1CCCN(C1)CCn2ccnc2 |
InChi: | InChI=1S/C11H20N4/c1-12-11-3-2-5-14(9-11)7-8-15-6-4-13-10-15/h4,6,10-12H,2-3,5,7-9H2,1H3 |
InChiKey: | InChIKey=YQCLWLWQRJGCJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.