* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34337311 |
English Synonyms: | UKRORGSYN-BB BBV-34337311 |
MDL Number.: | MFCD16789630 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C#CCNCCn1cnc2c1cccc2 |
InChi: | InChI=1S/C12H13N3/c1-2-7-13-8-9-15-10-14-11-5-3-4-6-12(11)15/h1,3-6,10,13H,7-9H2 |
InChiKey: | InChIKey=WXNCQJMALBAMIW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.