* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34337312 |
English Synonyms: | UKRORGSYN-BB BBV-34337312 |
MDL Number.: | MFCD16789631 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COCCNCCn1cnc2c1cccc2 |
InChi: | InChI=1S/C12H17N3O/c1-16-9-7-13-6-8-15-10-14-11-4-2-3-5-12(11)15/h2-5,10,13H,6-9H2,1H3 |
InChiKey: | InChIKey=GKJHVRCHOBTFTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.