* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34337343 |
English Synonyms: | UKRORGSYN-BB BBV-34337343 |
MDL Number.: | MFCD16789662 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCNCC(C)N(C)Cc1ccoc1C |
InChi: | InChI=1S/C12H22N2O/c1-5-13-8-10(2)14(4)9-12-6-7-15-11(12)3/h6-7,10,13H,5,8-9H2,1-4H3 |
InChiKey: | InChIKey=CBZCMLDGYXPFET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.